C10H12F2N2O3S — CID 79079912
N-(2,2-difluoroethyl)-2-methyl-5-sulfamoylbenzamide (PubChem CID 79079912) has the molecular formula C10H12F2N2O3S and a molecular weight of 278.28 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-methyl-5-sulfamoylbenzamide.
| Compound Name | N-(2,2-difluoroethyl)-2-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 79079912 |
| Molecular Formula | C10H12F2N2O3S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-methyl-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)NCC(F)F |
| InChI | InChI=1S/C10H12F2N2O3S/c1-6-2-3-7(18(13,16)17)4-8(6)10(15)14-5-9(11)12/h2-4,9H,5H2,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | OSOQHKSCYWPQLG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |