C10H15N3O3S — CID 65386253
N-(1-cyclopropylethyl)-4-sulfamoyl-1H-pyrrole-2-carboxamide (PubChem CID 65386253) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-4-sulfamoyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-(1-cyclopropylethyl)-4-sulfamoyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 65386253 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-(1-cyclopropylethyl)-4-sulfamoyl-1H-pyrrole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(S(N)(=O)=O)c[nH]1)C1CC1 |
| InChI | InChI=1S/C10H15N3O3S/c1-6(7-2-3-7)13-10(14)9-4-8(5-12-9)17(11,15)16/h4-7,12H,2-3H2,1H3,(H,13,14)(H2,11,15,16) |
| InChIKey | ZCOUIQZCDAUOSB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |