C9H12F3N3O4S — CID 65386759
4-sulfamoyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 65386759) has the molecular formula C9H12F3N3O4S and a molecular weight of 315.27 g/mol. Its IUPAC name is 4-sulfamoyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-sulfamoyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 65386759 |
| Molecular Formula | C9H12F3N3O4S |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 4-sulfamoyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | NS(=O)(=O)c1c[nH]c(C(=O)NCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H12F3N3O4S/c10-9(11,12)5-19-2-1-14-8(16)7-3-6(4-15-7)20(13,17)18/h3-4,15H,1-2,5H2,(H,14,16)(H2,13,17,18) |
| InChIKey | POSRWYNEROKVSD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|