C9H13F3N4O4S — CID 65386761
5-methyl-4-sulfamoyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-3-carboxamide (PubChem CID 65386761) has the molecular formula C9H13F3N4O4S and a molecular weight of 330.29 g/mol. Its IUPAC name is 5-methyl-4-sulfamoyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-4-sulfamoyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65386761 |
| Molecular Formula | C9H13F3N4O4S |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 5-methyl-4-sulfamoyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NCCOCC(F)(F)F)c1S(N)(=O)=O |
| InChI | InChI=1S/C9H13F3N4O4S/c1-5-7(21(13,18)19)6(16-15-5)8(17)14-2-3-20-4-9(10,11)12/h2-4H2,1H3,(H,14,17)(H,15,16)(H2,13,18,19) |
| InChIKey | UOMJEVGLMHCYIW-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|