C10H18N4O4S — CID 65387027
N-(2-ethoxyethyl)-5-ethyl-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 65387027) has the molecular formula C10H18N4O4S and a molecular weight of 290.35 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-5-ethyl-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-ethoxyethyl)-5-ethyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65387027 |
| Molecular Formula | C10H18N4O4S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | N-(2-ethoxyethyl)-5-ethyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | CCOCCNC(=O)c1n[nH]c(CC)c1S(N)(=O)=O |
| InChI | InChI=1S/C10H18N4O4S/c1-3-7-9(19(11,16)17)8(14-13-7)10(15)12-5-6-18-4-2/h3-6H2,1-2H3,(H,12,15)(H,13,14)(H2,11,16,17) |
| InChIKey | CBVAZWNLTJUAJD-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|