C11H20N4O4S — CID 65386835
N-(2-ethoxyethyl)-5-propyl-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 65386835) has the molecular formula C11H20N4O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-5-propyl-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-ethoxyethyl)-5-propyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65386835 |
| Molecular Formula | C11H20N4O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(2-ethoxyethyl)-5-propyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | CCCc1[nH]nc(C(=O)NCCOCC)c1S(N)(=O)=O |
| InChI | InChI=1S/C11H20N4O4S/c1-3-5-8-10(20(12,17)18)9(15-14-8)11(16)13-6-7-19-4-2/h3-7H2,1-2H3,(H,13,16)(H,14,15)(H2,12,17,18) |
| InChIKey | AWRMQEQBAPMDMI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|