C9H16N4O3S — CID 65373266
N-ethyl-5-propyl-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 65373266) has the molecular formula C9H16N4O3S and a molecular weight of 260.32 g/mol. Its IUPAC name is N-ethyl-5-propyl-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-ethyl-5-propyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65373266 |
| Molecular Formula | C9H16N4O3S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-ethyl-5-propyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | CCCc1[nH]nc(C(=O)NCC)c1S(N)(=O)=O |
| InChI | InChI=1S/C9H16N4O3S/c1-3-5-6-8(17(10,15)16)7(13-12-6)9(14)11-4-2/h3-5H2,1-2H3,(H,11,14)(H,12,13)(H2,10,15,16) |
| InChIKey | SZJLHFJYVZWIGY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |