C9H16N4O5S2 — CID 65386269
5-ethyl-N-(2-methylsulfonylethyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 65386269) has the molecular formula C9H16N4O5S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 5-ethyl-N-(2-methylsulfonylethyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | 5-ethyl-N-(2-methylsulfonylethyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65386269 |
| Molecular Formula | C9H16N4O5S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 5-ethyl-N-(2-methylsulfonylethyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)NCCS(C)(=O)=O)c1S(N)(=O)=O |
| InChI | InChI=1S/C9H16N4O5S2/c1-3-6-8(20(10,17)18)7(13-12-6)9(14)11-4-5-19(2,15)16/h3-5H2,1-2H3,(H,11,14)(H,12,13)(H2,10,17,18) |
| InChIKey | WUXUWQYWTABIPS-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 152.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |