C12H22N4O3S — CID 103465781
N-(2,2-dimethylbutyl)-5-ethyl-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 103465781) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-5-ethyl-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2,2-dimethylbutyl)-5-ethyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 103465781 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-(2,2-dimethylbutyl)-5-ethyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)NCC(C)(C)CC)c1S(N)(=O)=O |
| InChI | InChI=1S/C12H22N4O3S/c1-5-8-10(20(13,18)19)9(16-15-8)11(17)14-7-12(3,4)6-2/h5-7H2,1-4H3,(H,14,17)(H,15,16)(H2,13,18,19) |
| InChIKey | KQSPGPYRWPGTPF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |