About 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide
5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 103465733) has the molecular formula C13H22N4O3S
and a molecular weight of 314.41 g/mol. Its IUPAC name is 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| PubChem CID | 103465733 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | CCC(C)(C)CNC(=O)c1n[nH]c(C2CC2)c1S(N)(=O)=O |
| InChI | InChI=1S/C13H22N4O3S/c1-4-13(2,3)7-15-12(18)10-11(21(14,19)20)9(16-17-10)8-5-6-8/h8H,4-7H2,1-3H3,(H,15,18)(H,16,17)(H2,14,19,20) |
| InChIKey | AMBDJFMFHGGDNP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide?
The IUPAC name of 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide (CID 103465733) is 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide.
What is the SMILES notation for 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide?
The canonical SMILES for 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide is CCC(C)(C)CNC(=O)c1n[nH]c(C2CC2)c1S(N)(=O)=O.
What is the InChIKey of 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide?
The InChIKey is AMBDJFMFHGGDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O3S/c1-4-13(2,3)7-15-12(18)10-11(21(14,19)20)9(16-17-10)8-5-6-8/h8H,4-7H2,1-3H3,(H,15,18)(H,16,17)(H2,14,19,20).
What are the key properties of 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide?
5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide has a molecular weight of 314.41 g/mol, XLogP of 1.10, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-N-(2,2-dimethylbutyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 103465733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).