C11H18N4O3S — CID 65375951
N-butyl-5-cyclopropyl-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 65375951) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is N-butyl-5-cyclopropyl-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-butyl-5-cyclopropyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65375951 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-butyl-5-cyclopropyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | CCCCNC(=O)c1n[nH]c(C2CC2)c1S(N)(=O)=O |
| InChI | InChI=1S/C11H18N4O3S/c1-2-3-6-13-11(16)9-10(19(12,17)18)8(14-15-9)7-4-5-7/h7H,2-6H2,1H3,(H,13,16)(H,14,15)(H2,12,17,18) |
| InChIKey | BZLIUZDTOBYLJX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|