C13H21N3O4S — CID 65381478
4-methylpentyl 5-cyclopropyl-4-sulfamoyl-1H-pyrazole-3-carboxylate (PubChem CID 65381478) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is 4-methylpentyl 5-cyclopropyl-4-sulfamoyl-1H-pyrazole-3-carboxylate.
| Compound Name | 4-methylpentyl 5-cyclopropyl-4-sulfamoyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 65381478 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4-methylpentyl 5-cyclopropyl-4-sulfamoyl-1H-pyrazole-3-carboxylate |
| SMILES | CC(C)CCCOC(=O)c1n[nH]c(C2CC2)c1S(N)(=O)=O |
| InChI | InChI=1S/C13H21N3O4S/c1-8(2)4-3-7-20-13(17)11-12(21(14,18)19)10(15-16-11)9-5-6-9/h8-9H,3-7H2,1-2H3,(H,15,16)(H2,14,18,19) |
| InChIKey | YXLQWGGIUIDJCH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|