C13H22ClN3O3S — CID 65397482
5-ethyl-3-(3-ethylpentan-3-ylcarbamoyl)-1H-pyrazole-4-sulfonyl chloride (PubChem CID 65397482) has the molecular formula C13H22ClN3O3S and a molecular weight of 335.86 g/mol. Its IUPAC name is 5-ethyl-3-(3-ethylpentan-3-ylcarbamoyl)-1H-pyrazole-4-sulfonyl chloride.
| Compound Name | 5-ethyl-3-(3-ethylpentan-3-ylcarbamoyl)-1H-pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 65397482 |
| Molecular Formula | C13H22ClN3O3S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 5-ethyl-3-(3-ethylpentan-3-ylcarbamoyl)-1H-pyrazole-4-sulfonyl chloride |
| SMILES | CCc1[nH]nc(C(=O)NC(CC)(CC)CC)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C13H22ClN3O3S/c1-5-9-11(21(14,19)20)10(17-16-9)12(18)15-13(6-2,7-3)8-4/h5-8H2,1-4H3,(H,15,18)(H,16,17) |
| InChIKey | NIDXAEDNZZLZQE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |