C10H15ClN2O4S — CID 65396345
butyl 4-chlorosulfonyl-5-ethyl-1H-pyrazole-3-carboxylate (PubChem CID 65396345) has the molecular formula C10H15ClN2O4S and a molecular weight of 294.76 g/mol. Its IUPAC name is butyl 4-chlorosulfonyl-5-ethyl-1H-pyrazole-3-carboxylate.
| Compound Name | butyl 4-chlorosulfonyl-5-ethyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 65396345 |
| Molecular Formula | C10H15ClN2O4S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | butyl 4-chlorosulfonyl-5-ethyl-1H-pyrazole-3-carboxylate |
| SMILES | CCCCOC(=O)c1n[nH]c(CC)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H15ClN2O4S/c1-3-5-6-17-10(14)8-9(18(11,15)16)7(4-2)12-13-8/h3-6H2,1-2H3,(H,12,13) |
| InChIKey | VAFKYHCYKZVKHV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|