C11H16ClN3O4S — CID 82736008
5-ethyl-3-[(2-methyloxolan-3-yl)carbamoyl]-1H-pyrazole-4-sulfonyl chloride (PubChem CID 82736008) has the molecular formula C11H16ClN3O4S and a molecular weight of 321.79 g/mol. Its IUPAC name is 5-ethyl-3-[(2-methyloxolan-3-yl)carbamoyl]-1H-pyrazole-4-sulfonyl chloride.
| Compound Name | 5-ethyl-3-[(2-methyloxolan-3-yl)carbamoyl]-1H-pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 82736008 |
| Molecular Formula | C11H16ClN3O4S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 5-ethyl-3-[(2-methyloxolan-3-yl)carbamoyl]-1H-pyrazole-4-sulfonyl chloride |
| SMILES | CCc1[nH]nc(C(=O)NC2CCOC2C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H16ClN3O4S/c1-3-7-10(20(12,17)18)9(15-14-7)11(16)13-8-4-5-19-6(8)2/h6,8H,3-5H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | QXOKFCVVWBTXRQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |