C10H13ClN2O4S — CID 82735899
5-[(2-methyloxolan-3-yl)carbamoyl]-1H-pyrrole-3-sulfonyl chloride (PubChem CID 82735899) has the molecular formula C10H13ClN2O4S and a molecular weight of 292.74 g/mol. Its IUPAC name is 5-[(2-methyloxolan-3-yl)carbamoyl]-1H-pyrrole-3-sulfonyl chloride.
| Compound Name | 5-[(2-methyloxolan-3-yl)carbamoyl]-1H-pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 82735899 |
| Molecular Formula | C10H13ClN2O4S |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 5-[(2-methyloxolan-3-yl)carbamoyl]-1H-pyrrole-3-sulfonyl chloride |
| SMILES | CC1OCCC1NC(=O)c1cc(S(=O)(=O)Cl)c[nH]1 |
| InChI | InChI=1S/C10H13ClN2O4S/c1-6-8(2-3-17-6)13-10(14)9-4-7(5-12-9)18(11,15)16/h4-6,8,12H,2-3H2,1H3,(H,13,14) |
| InChIKey | DSINRUFNOQFXBJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |