C8H11ClN2O5S2 — CID 65367080
5-(2-methylsulfonylethylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride (PubChem CID 65367080) has the molecular formula C8H11ClN2O5S2 and a molecular weight of 314.77 g/mol. Its IUPAC name is 5-(2-methylsulfonylethylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride.
| Compound Name | 5-(2-methylsulfonylethylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65367080 |
| Molecular Formula | C8H11ClN2O5S2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 5-(2-methylsulfonylethylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride |
| SMILES | CS(=O)(=O)CCNC(=O)c1cc(S(=O)(=O)Cl)c[nH]1 |
| InChI | InChI=1S/C8H11ClN2O5S2/c1-17(13,14)3-2-10-8(12)7-4-6(5-11-7)18(9,15)16/h4-5,11H,2-3H2,1H3,(H,10,12) |
| InChIKey | UVIGOHLXMPYNIC-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |