C10H15ClN2O3S — CID 65367021
5-(pentylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride (PubChem CID 65367021) has the molecular formula C10H15ClN2O3S and a molecular weight of 278.76 g/mol. Its IUPAC name is 5-(pentylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride.
| Compound Name | 5-(pentylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65367021 |
| Molecular Formula | C10H15ClN2O3S |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 5-(pentylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride |
| SMILES | CCCCCNC(=O)c1cc(S(=O)(=O)Cl)c[nH]1 |
| InChI | InChI=1S/C10H15ClN2O3S/c1-2-3-4-5-12-10(14)9-6-8(7-13-9)17(11,15)16/h6-7,13H,2-5H2,1H3,(H,12,14) |
| InChIKey | IEXIGZCGIWMVGD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|