C10H15ClN2O4S — CID 65367433
5-(4-methoxybutan-2-ylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride (PubChem CID 65367433) has the molecular formula C10H15ClN2O4S and a molecular weight of 294.76 g/mol. Its IUPAC name is 5-(4-methoxybutan-2-ylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride.
| Compound Name | 5-(4-methoxybutan-2-ylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65367433 |
| Molecular Formula | C10H15ClN2O4S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 5-(4-methoxybutan-2-ylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride |
| SMILES | COCCC(C)NC(=O)c1cc(S(=O)(=O)Cl)c[nH]1 |
| InChI | InChI=1S/C10H15ClN2O4S/c1-7(3-4-17-2)13-10(14)9-5-8(6-12-9)18(11,15)16/h5-7,12H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | FRFRHMCMEUWGJG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |