C11H17N3O6S — CID 119942974
(2S)-2-[[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]propanoic acid (PubChem CID 119942974) has the molecular formula C11H17N3O6S and a molecular weight of 319.34 g/mol. Its IUPAC name is (2S)-2-[[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119942974 |
| Molecular Formula | C11H17N3O6S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (2S)-2-[[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]propanoic acid |
| SMILES | COCCNS(=O)(=O)c1c[nH]c(C(=O)N[C@@H](C)C(=O)O)c1 |
| InChI | InChI=1S/C11H17N3O6S/c1-7(11(16)17)14-10(15)9-5-8(6-12-9)21(18,19)13-3-4-20-2/h5-7,12-13H,3-4H2,1-2H3,(H,14,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | UNGHUFWJRIDCQV-ZETCQYMHSA-N |
| XLogP | -0.86 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|