C16H23N3O6S — CID 120683882
(3aS,6aR)-2-[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120683882) has the molecular formula C16H23N3O6S and a molecular weight of 385.44 g/mol. Its IUPAC name is (3aS,6aR)-2-[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120683882 |
| Molecular Formula | C16H23N3O6S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (3aS,6aR)-2-[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | COCCNS(=O)(=O)c1c[nH]c(C(=O)N2C[C@@H]3CCC[C@@]3(C(=O)O)C2)c1 |
| InChI | InChI=1S/C16H23N3O6S/c1-25-6-5-18-26(23,24)12-7-13(17-8-12)14(20)19-9-11-3-2-4-16(11,10-19)15(21)22/h7-8,11,17-18H,2-6,9-10H2,1H3,(H,21,22)/t11-,16+/m0/s1 |
| InChIKey | HFADTCINMOXJHK-MEDUHNTESA-N |
| XLogP | 0.27 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|