C14H23N3O6S — CID 119357757
4-[[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 119357757) has the molecular formula C14H23N3O6S and a molecular weight of 361.42 g/mol. Its IUPAC name is 4-[[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | 4-[[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119357757 |
| Molecular Formula | C14H23N3O6S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 4-[[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | COCCNS(=O)(=O)c1c[nH]c(C(=O)NC(C)(C)CCC(=O)O)c1 |
| InChI | InChI=1S/C14H23N3O6S/c1-14(2,5-4-12(18)19)17-13(20)11-8-10(9-15-11)24(21,22)16-6-7-23-3/h8-9,15-16H,4-7H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | KRGYNSZWBJPSPG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|