C13H15N3O5S — CID 56861914
3-(2-methoxyethylsulfamoyl)-5-(1H-pyrazol-5-yl)benzoic acid (PubChem CID 56861914) has the molecular formula C13H15N3O5S and a molecular weight of 325.35 g/mol. Its IUPAC name is 3-(2-methoxyethylsulfamoyl)-5-(1H-pyrazol-5-yl)benzoic acid.
| Compound Name | 3-(2-methoxyethylsulfamoyl)-5-(1H-pyrazol-5-yl)benzoic acid |
|---|---|
| PubChem CID | 56861914 |
| Molecular Formula | C13H15N3O5S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-(2-methoxyethylsulfamoyl)-5-(1H-pyrazol-5-yl)benzoic acid |
| SMILES | COCCNS(=O)(=O)c1cc(C(=O)O)cc(-c2ccn[nH]2)c1 |
| InChI | InChI=1S/C13H15N3O5S/c1-21-5-4-15-22(19,20)11-7-9(12-2-3-14-16-12)6-10(8-11)13(17)18/h2-3,6-8,15H,4-5H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | OILMAQVGXRJECN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|