C19H23NO6S — CID 95486381
3-[3-[(1R)-1-methoxyethyl]phenyl]-5-(2-methoxyethylsulfamoyl)benzoic acid (PubChem CID 95486381) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is 3-[3-[(1R)-1-methoxyethyl]phenyl]-5-(2-methoxyethylsulfamoyl)benzoic acid.
| Compound Name | 3-[3-[(1R)-1-methoxyethyl]phenyl]-5-(2-methoxyethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 95486381 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 3-[3-[(1R)-1-methoxyethyl]phenyl]-5-(2-methoxyethylsulfamoyl)benzoic acid |
| SMILES | COCCNS(=O)(=O)c1cc(C(=O)O)cc(-c2cccc([C@@H](C)OC)c2)c1 |
| InChI | InChI=1S/C19H23NO6S/c1-13(26-3)14-5-4-6-15(9-14)16-10-17(19(21)22)12-18(11-16)27(23,24)20-7-8-25-2/h4-6,9-13,20H,7-8H2,1-3H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | NLGBOVINZLDKMQ-CYBMUJFWSA-N |
| XLogP | 2.68 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|