C19H23NO5S — CID 56864067
3-[3-(1-methoxyethyl)phenyl]-5-(propan-2-ylsulfamoyl)benzoic acid (PubChem CID 56864067) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is 3-[3-(1-methoxyethyl)phenyl]-5-(propan-2-ylsulfamoyl)benzoic acid.
| Compound Name | 3-[3-(1-methoxyethyl)phenyl]-5-(propan-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 56864067 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 3-[3-(1-methoxyethyl)phenyl]-5-(propan-2-ylsulfamoyl)benzoic acid |
| SMILES | COC(C)c1cccc(-c2cc(C(=O)O)cc(S(=O)(=O)NC(C)C)c2)c1 |
| InChI | InChI=1S/C19H23NO5S/c1-12(2)20-26(23,24)18-10-16(9-17(11-18)19(21)22)15-7-5-6-14(8-15)13(3)25-4/h5-13,20H,1-4H3,(H,21,22) |
| InChIKey | JKLWBJURVLKHPL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |