C18H23N3O6S2 — CID 55570733
3-(2-methoxyethylsulfamoyl)-N-[1-(3-sulfamoylphenyl)ethyl]benzamide (PubChem CID 55570733) has the molecular formula C18H23N3O6S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3-(2-methoxyethylsulfamoyl)-N-[1-(3-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 3-(2-methoxyethylsulfamoyl)-N-[1-(3-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55570733 |
| Molecular Formula | C18H23N3O6S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 3-(2-methoxyethylsulfamoyl)-N-[1-(3-sulfamoylphenyl)ethyl]benzamide |
| SMILES | COCCNS(=O)(=O)c1cccc(C(=O)NC(C)c2cccc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C18H23N3O6S2/c1-13(14-5-3-7-16(11-14)28(19,23)24)21-18(22)15-6-4-8-17(12-15)29(25,26)20-9-10-27-2/h3-8,11-13,20H,9-10H2,1-2H3,(H,21,22)(H2,19,23,24) |
| InChIKey | AJJZDTDZCVZEDD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|