C16H28N4O5S — CID 120890345
4-(2-methoxyethylsulfamoyl)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-1H-pyrrole-2-carboxamide (PubChem CID 120890345) has the molecular formula C16H28N4O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfamoyl)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(2-methoxyethylsulfamoyl)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 120890345 |
| Molecular Formula | C16H28N4O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-(2-methoxyethylsulfamoyl)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-1H-pyrrole-2-carboxamide |
| SMILES | COCCNS(=O)(=O)c1c[nH]c(C(=O)NCC2(COC)CCNCC2)c1 |
| InChI | InChI=1S/C16H28N4O5S/c1-24-8-7-20-26(22,23)13-9-14(18-10-13)15(21)19-11-16(12-25-2)3-5-17-6-4-16/h9-10,17-18,20H,3-8,11-12H2,1-2H3,(H,19,21) |
| InChIKey | WGWWHTKCFFWJRN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|