C16H19N3O6S — CID 119372735
(2S)-2-[[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]-2-phenylacetic acid (PubChem CID 119372735) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is (2S)-2-[[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 119372735 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (2S)-2-[[4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]-2-phenylacetic acid |
| SMILES | COCCNS(=O)(=O)c1c[nH]c(C(=O)N[C@H](C(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H19N3O6S/c1-25-8-7-18-26(23,24)12-9-13(17-10-12)15(20)19-14(16(21)22)11-5-3-2-4-6-11/h2-6,9-10,14,17-18H,7-8H2,1H3,(H,19,20)(H,21,22)/t14-/m0/s1 |
| InChIKey | LMFRBFSNMHSFJO-AWEZNQCLSA-N |
| XLogP | 0.50 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|