C20H24N2O6S — CID 97324356
(2R,3S)-3-[[4-(2-methoxyethylsulfamoyl)benzoyl]amino]-2-methyl-3-phenylpropanoic acid (PubChem CID 97324356) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is (2R,3S)-3-[[4-(2-methoxyethylsulfamoyl)benzoyl]amino]-2-methyl-3-phenylpropanoic acid.
| Compound Name | (2R,3S)-3-[[4-(2-methoxyethylsulfamoyl)benzoyl]amino]-2-methyl-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 97324356 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (2R,3S)-3-[[4-(2-methoxyethylsulfamoyl)benzoyl]amino]-2-methyl-3-phenylpropanoic acid |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)N[C@H](c2ccccc2)[C@@H](C)C(=O)O)cc1 |
| InChI | InChI=1S/C20H24N2O6S/c1-14(20(24)25)18(15-6-4-3-5-7-15)22-19(23)16-8-10-17(11-9-16)29(26,27)21-12-13-28-2/h3-11,14,18,21H,12-13H2,1-2H3,(H,22,23)(H,24,25)/t14-,18+/m1/s1 |
| InChIKey | UYMKLMWSNBNTDL-KDOFPFPSSA-N |
| XLogP | 1.80 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|