C13H18N2O6S — CID 119172393
2-[[4-(2-methoxyethylsulfamoyl)benzoyl]-methylamino]acetic acid (PubChem CID 119172393) has the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-[[4-(2-methoxyethylsulfamoyl)benzoyl]-methylamino]acetic acid.
| Compound Name | 2-[[4-(2-methoxyethylsulfamoyl)benzoyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 119172393 |
| Molecular Formula | C13H18N2O6S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-[[4-(2-methoxyethylsulfamoyl)benzoyl]-methylamino]acetic acid |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)N(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C13H18N2O6S/c1-15(9-12(16)17)13(18)10-3-5-11(6-4-10)22(19,20)14-7-8-21-2/h3-6,14H,7-9H2,1-2H3,(H,16,17) |
| InChIKey | UJOXLDZTXOACHU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|