C16H28ClN3O4S — CID 119654430
N-(3-amino-2,2-dimethylpropyl)-4-(2-methoxyethylsulfamoyl)-N-methylbenzamide;hydrochloride (PubChem CID 119654430) has the molecular formula C16H28ClN3O4S and a molecular weight of 393.94 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-4-(2-methoxyethylsulfamoyl)-N-methylbenzamide;hydrochloride.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-4-(2-methoxyethylsulfamoyl)-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119654430 |
| Molecular Formula | C16H28ClN3O4S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-4-(2-methoxyethylsulfamoyl)-N-methylbenzamide;hydrochloride |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)N(C)CC(C)(C)CN)cc1.Cl |
| InChI | InChI=1S/C16H27N3O4S.ClH/c1-16(2,11-17)12-19(3)15(20)13-5-7-14(8-6-13)24(21,22)18-9-10-23-4;/h5-8,18H,9-12,17H2,1-4H3;1H |
| InChIKey | DYORXOHCFDOMAN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|