C16H28ClN3O4S — CID 119607015
N-(1-amino-2,3-dimethylbutan-2-yl)-4-(2-methoxyethylsulfamoyl)benzamide;hydrochloride (PubChem CID 119607015) has the molecular formula C16H28ClN3O4S and a molecular weight of 393.94 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-4-(2-methoxyethylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-4-(2-methoxyethylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119607015 |
| Molecular Formula | C16H28ClN3O4S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-4-(2-methoxyethylsulfamoyl)benzamide;hydrochloride |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)NC(C)(CN)C(C)C)cc1.Cl |
| InChI | InChI=1S/C16H27N3O4S.ClH/c1-12(2)16(3,11-17)19-15(20)13-5-7-14(8-6-13)24(21,22)18-9-10-23-4;/h5-8,12,18H,9-11,17H2,1-4H3,(H,19,20);1H |
| InChIKey | XUYBAEKWBJGNJL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|