C24H28N2O4S2 — CID 74756714
4-(2-methoxyethylsulfamoyl)-N-[(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]benzamide (PubChem CID 74756714) has the molecular formula C24H28N2O4S2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfamoyl)-N-[(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]benzamide.
| Compound Name | 4-(2-methoxyethylsulfamoyl)-N-[(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]benzamide |
|---|---|
| PubChem CID | 74756714 |
| Molecular Formula | C24H28N2O4S2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 4-(2-methoxyethylsulfamoyl)-N-[(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)NC(c2ccc(C(C)C)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C24H28N2O4S2/c1-17(2)18-6-8-19(9-7-18)23(22-5-4-16-31-22)26-24(27)20-10-12-21(13-11-20)32(28,29)25-14-15-30-3/h4-13,16-17,23,25H,14-15H2,1-3H3,(H,26,27) |
| InChIKey | AWPSRSLFSDWWNQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|