C17H20N2O5S2 — CID 46534149
methyl 3-[[4-(ethylsulfamoyl)benzoyl]amino]-3-thiophen-2-ylpropanoate (PubChem CID 46534149) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl 3-[[4-(ethylsulfamoyl)benzoyl]amino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[[4-(ethylsulfamoyl)benzoyl]amino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 46534149 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | methyl 3-[[4-(ethylsulfamoyl)benzoyl]amino]-3-thiophen-2-ylpropanoate |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)NC(CC(=O)OC)c2cccs2)cc1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-3-18-26(22,23)13-8-6-12(7-9-13)17(21)19-14(11-16(20)24-2)15-5-4-10-25-15/h4-10,14,18H,3,11H2,1-2H3,(H,19,21) |
| InChIKey | IHGMHYZRDITASD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |