C19H23ClN2O5S2 — CID 46603309
methyl 3-[[2-chloro-5-(diethylsulfamoyl)benzoyl]amino]-3-thiophen-2-ylpropanoate (PubChem CID 46603309) has the molecular formula C19H23ClN2O5S2 and a molecular weight of 458.99 g/mol. Its IUPAC name is methyl 3-[[2-chloro-5-(diethylsulfamoyl)benzoyl]amino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[[2-chloro-5-(diethylsulfamoyl)benzoyl]amino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 46603309 |
| Molecular Formula | C19H23ClN2O5S2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | methyl 3-[[2-chloro-5-(diethylsulfamoyl)benzoyl]amino]-3-thiophen-2-ylpropanoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)NC(CC(=O)OC)c2cccs2)c1 |
| InChI | InChI=1S/C19H23ClN2O5S2/c1-4-22(5-2)29(25,26)13-8-9-15(20)14(11-13)19(24)21-16(12-18(23)27-3)17-7-6-10-28-17/h6-11,16H,4-5,12H2,1-3H3,(H,21,24) |
| InChIKey | QLRAXAIFBCJQOT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |