C17H19ClN2O5S2 — CID 55812102
methyl 2-[[2-chloro-5-(diethylsulfamoyl)benzoyl]amino]thiophene-3-carboxylate (PubChem CID 55812102) has the molecular formula C17H19ClN2O5S2 and a molecular weight of 430.94 g/mol. Its IUPAC name is methyl 2-[[2-chloro-5-(diethylsulfamoyl)benzoyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-chloro-5-(diethylsulfamoyl)benzoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 55812102 |
| Molecular Formula | C17H19ClN2O5S2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | methyl 2-[[2-chloro-5-(diethylsulfamoyl)benzoyl]amino]thiophene-3-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)Nc2sccc2C(=O)OC)c1 |
| InChI | InChI=1S/C17H19ClN2O5S2/c1-4-20(5-2)27(23,24)11-6-7-14(18)13(10-11)15(21)19-16-12(8-9-26-16)17(22)25-3/h6-10H,4-5H2,1-3H3,(H,19,21) |
| InChIKey | UWXHUIDBYIZIKT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |