C23H24N2O5S2 — CID 41044645
ethyl 2-[[4-[benzyl(ethyl)sulfamoyl]benzoyl]amino]thiophene-3-carboxylate (PubChem CID 41044645) has the molecular formula C23H24N2O5S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is ethyl 2-[[4-[benzyl(ethyl)sulfamoyl]benzoyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-[benzyl(ethyl)sulfamoyl]benzoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 41044645 |
| Molecular Formula | C23H24N2O5S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | ethyl 2-[[4-[benzyl(ethyl)sulfamoyl]benzoyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccsc1NC(=O)c1ccc(S(=O)(=O)N(CC)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O5S2/c1-3-25(16-17-8-6-5-7-9-17)32(28,29)19-12-10-18(11-13-19)21(26)24-22-20(14-15-31-22)23(27)30-4-2/h5-15H,3-4,16H2,1-2H3,(H,24,26) |
| InChIKey | LXSWGMFTIIPUHC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |