C20H21N3O4S — CID 109060838
4-[benzyl(ethyl)sulfamoyl]-N-(5-methyl-1,2-oxazol-3-yl)benzamide (PubChem CID 109060838) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-(5-methyl-1,2-oxazol-3-yl)benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 109060838 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-3-23(14-16-7-5-4-6-8-16)28(25,26)18-11-9-17(10-12-18)20(24)21-19-13-15(2)27-22-19/h4-13H,3,14H2,1-2H3,(H,21,22,24) |
| InChIKey | XVLHGBWRORJAHM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |