C25H24N4O5S — CID 2526591
2-[5-(dibenzylsulfamoyl)-2-oxo-1-pyridinyl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 2526591) has the molecular formula C25H24N4O5S and a molecular weight of 492.56 g/mol. Its IUPAC name is 2-[5-(dibenzylsulfamoyl)-2-oxo-1-pyridinyl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[5-(dibenzylsulfamoyl)-2-oxo-1-pyridinyl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 2526591 |
| Molecular Formula | C25H24N4O5S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2-[5-(dibenzylsulfamoyl)-2-oxo-1-pyridinyl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)Cn2cc(S(=O)(=O)N(Cc3ccccc3)Cc3ccccc3)ccc2=O)no1 |
| InChI | InChI=1S/C25H24N4O5S/c1-19-14-23(27-34-19)26-24(30)18-28-17-22(12-13-25(28)31)35(32,33)29(15-20-8-4-2-5-9-20)16-21-10-6-3-7-11-21/h2-14,17H,15-16,18H2,1H3,(H,26,27,30) |
| InChIKey | VYEBZLZJWFUZEL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |