C19H25N3O4S — CID 7828980
2-[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[(2R)-4-phenylbutan-2-yl]acetamide (PubChem CID 7828980) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[(2R)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[(2R)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 7828980 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[(2R)-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)Cn1cc(S(=O)(=O)N(C)C)ccc1=O |
| InChI | InChI=1S/C19H25N3O4S/c1-15(9-10-16-7-5-4-6-8-16)20-18(23)14-22-13-17(11-12-19(22)24)27(25,26)21(2)3/h4-8,11-13,15H,9-10,14H2,1-3H3,(H,20,23)/t15-/m1/s1 |
| InChIKey | CPHCYNVAJZIWCH-OAHLLOKOSA-N |
| XLogP | 1.24 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |