C15H18N4O6S2 — CID 38932613
2-[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 38932613) has the molecular formula C15H18N4O6S2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 38932613 |
| Molecular Formula | C15H18N4O6S2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2-[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(=O)n(CC(=O)Nc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C15H18N4O6S2/c1-18(2)27(24,25)13-7-8-15(21)19(9-13)10-14(20)17-11-3-5-12(6-4-11)26(16,22)23/h3-9H,10H2,1-2H3,(H,17,20)(H2,16,22,23) |
| InChIKey | PLXZSWCILBBQKX-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |