C16H18ClN3O4S — CID 7828841
N-(4-chloro-2-methylphenyl)-2-[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]acetamide (PubChem CID 7828841) has the molecular formula C16H18ClN3O4S and a molecular weight of 383.86 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-2-[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]acetamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-2-[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 7828841 |
| Molecular Formula | C16H18ClN3O4S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-2-[5-(dimethylsulfamoyl)-2-oxo-1-pyridinyl]acetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)Cn1cc(S(=O)(=O)N(C)C)ccc1=O |
| InChI | InChI=1S/C16H18ClN3O4S/c1-11-8-12(17)4-6-14(11)18-15(21)10-20-9-13(5-7-16(20)22)25(23,24)19(2)3/h4-9H,10H2,1-3H3,(H,18,21) |
| InChIKey | DWDMOZBEYOJNBT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |