C16H18ClN3O4S2 — CID 2425482
2-[[4-chloro-3-(diethylsulfamoyl)benzoyl]amino]thiophene-3-carboxamide (PubChem CID 2425482) has the molecular formula C16H18ClN3O4S2 and a molecular weight of 415.92 g/mol. Its IUPAC name is 2-[[4-chloro-3-(diethylsulfamoyl)benzoyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[4-chloro-3-(diethylsulfamoyl)benzoyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 2425482 |
| Molecular Formula | C16H18ClN3O4S2 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 2-[[4-chloro-3-(diethylsulfamoyl)benzoyl]amino]thiophene-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2sccc2C(N)=O)ccc1Cl |
| InChI | InChI=1S/C16H18ClN3O4S2/c1-3-20(4-2)26(23,24)13-9-10(5-6-12(13)17)15(22)19-16-11(14(18)21)7-8-25-16/h5-9H,3-4H2,1-2H3,(H2,18,21)(H,19,22) |
| InChIKey | QUAYXOJSFGMVBH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |