C14H13ClN2O3S — CID 81229017
methyl 3-[(4-chloropyridine-3-carbonyl)amino]-3-thiophen-2-ylpropanoate (PubChem CID 81229017) has the molecular formula C14H13ClN2O3S and a molecular weight of 324.79 g/mol. Its IUPAC name is methyl 3-[(4-chloropyridine-3-carbonyl)amino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[(4-chloropyridine-3-carbonyl)amino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 81229017 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | methyl 3-[(4-chloropyridine-3-carbonyl)amino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)CC(NC(=O)c1cnccc1Cl)c1cccs1 |
| InChI | InChI=1S/C14H13ClN2O3S/c1-20-13(18)7-11(12-3-2-6-21-12)17-14(19)9-8-16-5-4-10(9)15/h2-6,8,11H,7H2,1H3,(H,17,19) |
| InChIKey | AGCBVVSSBHQZCP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |