C17H17ClN2O3 — CID 119050142
methyl 3-[(3-chloro-2-methylbenzoyl)amino]-3-pyridin-4-ylpropanoate (PubChem CID 119050142) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is methyl 3-[(3-chloro-2-methylbenzoyl)amino]-3-pyridin-4-ylpropanoate.
| Compound Name | methyl 3-[(3-chloro-2-methylbenzoyl)amino]-3-pyridin-4-ylpropanoate |
|---|---|
| PubChem CID | 119050142 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | methyl 3-[(3-chloro-2-methylbenzoyl)amino]-3-pyridin-4-ylpropanoate |
| SMILES | COC(=O)CC(NC(=O)c1cccc(Cl)c1C)c1ccncc1 |
| InChI | InChI=1S/C17H17ClN2O3/c1-11-13(4-3-5-14(11)18)17(22)20-15(10-16(21)23-2)12-6-8-19-9-7-12/h3-9,15H,10H2,1-2H3,(H,20,22) |
| InChIKey | GQTPWSIYJRZERR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |