C23H20ClN3O4 — CID 55633058
methyl 3-(4-chlorophenyl)-3-[[3-(pyridine-3-carbonylamino)benzoyl]amino]propanoate (PubChem CID 55633058) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-3-[[3-(pyridine-3-carbonylamino)benzoyl]amino]propanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-3-[[3-(pyridine-3-carbonylamino)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 55633058 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-3-[[3-(pyridine-3-carbonylamino)benzoyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cccc(NC(=O)c2cccnc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClN3O4/c1-31-21(28)13-20(15-7-9-18(24)10-8-15)27-22(29)16-4-2-6-19(12-16)26-23(30)17-5-3-11-25-14-17/h2-12,14,20H,13H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | ILNXMWFOGDYYTQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |