C20H16Cl2N2O3 — CID 55822876
methyl 3-(4-chlorophenyl)-3-[(2-chloroquinoline-6-carbonyl)amino]propanoate (PubChem CID 55822876) has the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-3-[(2-chloroquinoline-6-carbonyl)amino]propanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-3-[(2-chloroquinoline-6-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 55822876 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-3-[(2-chloroquinoline-6-carbonyl)amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccc2nc(Cl)ccc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O3/c1-27-19(25)11-17(12-2-6-15(21)7-3-12)24-20(26)14-4-8-16-13(10-14)5-9-18(22)23-16/h2-10,17H,11H2,1H3,(H,24,26) |
| InChIKey | QVJOZDXVMTXCOC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|