C26H27N3O4 — CID 46411380
propan-2-yl 3-(4-methylphenyl)-3-[[3-(pyridine-3-carbonylamino)benzoyl]amino]propanoate (PubChem CID 46411380) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is propan-2-yl 3-(4-methylphenyl)-3-[[3-(pyridine-3-carbonylamino)benzoyl]amino]propanoate.
| Compound Name | propan-2-yl 3-(4-methylphenyl)-3-[[3-(pyridine-3-carbonylamino)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 46411380 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | propan-2-yl 3-(4-methylphenyl)-3-[[3-(pyridine-3-carbonylamino)benzoyl]amino]propanoate |
| SMILES | Cc1ccc(C(CC(=O)OC(C)C)NC(=O)c2cccc(NC(=O)c3cccnc3)c2)cc1 |
| InChI | InChI=1S/C26H27N3O4/c1-17(2)33-24(30)15-23(19-11-9-18(3)10-12-19)29-25(31)20-6-4-8-22(14-20)28-26(32)21-7-5-13-27-16-21/h4-14,16-17,23H,15H2,1-3H3,(H,28,32)(H,29,31) |
| InChIKey | ULGIPWANGGXHBK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |