C22H18F3N3O2 — CID 51940025
N-[3-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]carbamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 51940025) has the molecular formula C22H18F3N3O2 and a molecular weight of 413.40 g/mol. Its IUPAC name is N-[3-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]carbamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]carbamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51940025 |
| Molecular Formula | C22H18F3N3O2 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[3-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]carbamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1cccc(NC(=O)c2cccnc2)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18F3N3O2/c1-14(15-7-9-18(10-8-15)22(23,24)25)27-20(29)16-4-2-6-19(12-16)28-21(30)17-5-3-11-26-13-17/h2-14H,1H3,(H,27,29)(H,28,30)/t14-/m0/s1 |
| InChIKey | YXZFMZNVBYTTPZ-AWEZNQCLSA-N |
| XLogP | 4.84 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |