methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate

C17H15BrClNO3 — CID 51256783

IUPACmethyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate
SMILESCOC(=O)CC(NC(=O)c1ccccc1Br)c1ccccc1Cl
InChIInChI=1S/C17H15BrClNO3/c1-23-16(21)10-15(12-7-3-5-9-14(12)19)20-17(22)11-6-2-4-8-13(11)18/h2-9,15H,10H2,1H3,(H,20,22)
InChIKeyPAMYZSJOYOTEMM-UHFFFAOYSA-N
MW396.67 g/mol
LogP4.14
Rot. Bonds5

About methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate

methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate (PubChem CID 51256783) has the molecular formula C17H15BrClNO3 and a molecular weight of 396.67 g/mol. Its IUPAC name is methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate.

Molecular Properties

Compound Namemethyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate
PubChem CID51256783
Molecular FormulaC17H15BrClNO3
Molecular Weight396.67 g/mol
Exact Mass394.99
IUPAC Namemethyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate
SMILESCOC(=O)CC(NC(=O)c1ccccc1Br)c1ccccc1Cl
InChIInChI=1S/C17H15BrClNO3/c1-23-16(21)10-15(12-7-3-5-9-14(12)19)20-17(22)11-6-2-4-8-13(11)18/h2-9,15H,10H2,1H3,(H,20,22)
InChIKeyPAMYZSJOYOTEMM-UHFFFAOYSA-N
XLogP4.14
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500396.67
LogP ≤ 54.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate?
The IUPAC name of methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate (CID 51256783) is methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate.
What is the SMILES notation for methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate?
The canonical SMILES for methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate is COC(=O)CC(NC(=O)c1ccccc1Br)c1ccccc1Cl.
What is the InChIKey of methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate?
The InChIKey is PAMYZSJOYOTEMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrClNO3/c1-23-16(21)10-15(12-7-3-5-9-14(12)19)20-17(22)11-6-2-4-8-13(11)18/h2-9,15H,10H2,1H3,(H,20,22).
What are the key properties of methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate?
methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate has a molecular weight of 396.67 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate is sourced from PubChem (CID 51256783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).