C17H15BrClNO3 — CID 51256783
methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate (PubChem CID 51256783) has the molecular formula C17H15BrClNO3 and a molecular weight of 396.67 g/mol. Its IUPAC name is methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate.
| Compound Name | methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 51256783 |
| Molecular Formula | C17H15BrClNO3 |
| Molecular Weight | 396.67 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | methyl 3-[(2-bromobenzoyl)amino]-3-(2-chlorophenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccccc1Br)c1ccccc1Cl |
| InChI | InChI=1S/C17H15BrClNO3/c1-23-16(21)10-15(12-7-3-5-9-14(12)19)20-17(22)11-6-2-4-8-13(11)18/h2-9,15H,10H2,1H3,(H,20,22) |
| InChIKey | PAMYZSJOYOTEMM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |